ChemNet > CAS > 118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
| product Name |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
| CAS No |
118337-33-0 |
| Synonyms |
2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| Molecular Formula |
C11H8BrClOS |
| Molecular Weight |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| Molecular Structure |
![118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/348/34859.gif)
|
| Density |
1.632g/cm3 |
| Melting point |
94℃ |
| Boiling point |
396.2°C at 760 mmHg |
| Refractive index |
1.676 |
| Flash point |
193.4°C |
| Vapour Pressur |
1.73E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
